C28H32O14 — CID 73046753
1-methoxy-2-(methoxymethyl)-3-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxan-2-yl]oxyanthracene-9,10-dione (PubChem CID 73046753) has the molecular formula C28H32O14 and a molecular weight of 592.55 g/mol. Its IUPAC name is 1-methoxy-2-(methoxymethyl)-3-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxan-2-yl]oxyanthracene-9,10-dione.
| Compound Name | 1-methoxy-2-(methoxymethyl)-3-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxan-2-yl]oxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 73046753 |
| Molecular Formula | C28H32O14 |
| Molecular Weight | 592.55 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | 1-methoxy-2-(methoxymethyl)-3-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxan-2-yl]oxyanthracene-9,10-dione |
| SMILES | COCc1c(OC2OC(COC3OCC(O)C(O)C3O)C(O)C(O)C2O)cc2c(c1OC)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C28H32O14/c1-37-8-14-16(7-13-18(26(14)38-2)20(31)12-6-4-3-5-11(12)19(13)30)41-28-25(36)23(34)22(33)17(42-28)10-40-27-24(35)21(32)15(29)9-39-27/h3-7,15,17,21-25,27-29,32-36H,8-10H2,1-2H3 |
| InChIKey | NUEGCZCBUUHEIJ-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 210.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.55 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|