C25H30N2O4 — CID 7304823
ethyl (3S,4R)-4-[4-(dimethylamino)phenyl]-5,5-dimethyl-1-(4-methylphenyl)-2,6-dioxopiperidine-3-carboxylate (PubChem CID 7304823) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is ethyl (3S,4R)-4-[4-(dimethylamino)phenyl]-5,5-dimethyl-1-(4-methylphenyl)-2,6-dioxopiperidine-3-carboxylate.
| Compound Name | ethyl (3S,4R)-4-[4-(dimethylamino)phenyl]-5,5-dimethyl-1-(4-methylphenyl)-2,6-dioxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 7304823 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | ethyl (3S,4R)-4-[4-(dimethylamino)phenyl]-5,5-dimethyl-1-(4-methylphenyl)-2,6-dioxopiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)N(c2ccc(C)cc2)C(=O)C(C)(C)[C@H]1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C25H30N2O4/c1-7-31-23(29)20-21(17-10-14-18(15-11-17)26(5)6)25(3,4)24(30)27(22(20)28)19-12-8-16(2)9-13-19/h8-15,20-21H,7H2,1-6H3/t20-,21-/m0/s1 |
| InChIKey | MIZWCDRSIKHJLS-SFTDATJTSA-N |
| XLogP | 3.92 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|