C21H23ClN2O4 — CID 73048238
N-benzyl-4-[2-(3-chlorophenyl)pyrrolidin-1-yl]-2,3-dihydroxy-4-oxobutanamide (PubChem CID 73048238) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is N-benzyl-4-[2-(3-chlorophenyl)pyrrolidin-1-yl]-2,3-dihydroxy-4-oxobutanamide.
| Compound Name | N-benzyl-4-[2-(3-chlorophenyl)pyrrolidin-1-yl]-2,3-dihydroxy-4-oxobutanamide |
|---|---|
| PubChem CID | 73048238 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N-benzyl-4-[2-(3-chlorophenyl)pyrrolidin-1-yl]-2,3-dihydroxy-4-oxobutanamide |
| SMILES | O=C(NCc1ccccc1)C(O)C(O)C(=O)N1CCCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H23ClN2O4/c22-16-9-4-8-15(12-16)17-10-5-11-24(17)21(28)19(26)18(25)20(27)23-13-14-6-2-1-3-7-14/h1-4,6-9,12,17-19,25-26H,5,10-11,13H2,(H,23,27) |
| InChIKey | UPSOWFNLCOSXGA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |