C18H24N2O2S2 — CID 7304939
(2S,3R)-1,4-bis(2-pyridin-2-ylethylsulfanyl)butane-2,3-diol (PubChem CID 7304939) has the molecular formula C18H24N2O2S2 and a molecular weight of 364.54 g/mol. Its IUPAC name is (2S,3R)-1,4-bis(2-pyridin-2-ylethylsulfanyl)butane-2,3-diol.
| Compound Name | (2S,3R)-1,4-bis(2-pyridin-2-ylethylsulfanyl)butane-2,3-diol |
|---|---|
| PubChem CID | 7304939 |
| Molecular Formula | C18H24N2O2S2 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (2S,3R)-1,4-bis(2-pyridin-2-ylethylsulfanyl)butane-2,3-diol |
| SMILES | O[C@H](CSCCc1ccccn1)[C@@H](O)CSCCc1ccccn1 |
| InChI | InChI=1S/C18H24N2O2S2/c21-17(13-23-11-7-15-5-1-3-9-19-15)18(22)14-24-12-8-16-6-2-4-10-20-16/h1-6,9-10,17-18,21-22H,7-8,11-14H2/t17-,18+ |
| InChIKey | KBAUUQDVOZQIFT-HDICACEKSA-N |
| XLogP | 2.45 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|