About methyl 2-(3-butan-2-yl-1-oxo-2,3-dihydroisoquinolin-4-ylidene)acetate
methyl 2-(3-butan-2-yl-1-oxo-2,3-dihydroisoquinolin-4-ylidene)acetate (PubChem CID 73049977) has the molecular formula C16H19NO3
and a molecular weight of 273.33 g/mol. Its IUPAC name is methyl 2-(3-butan-2-yl-1-oxo-2,3-dihydroisoquinolin-4-ylidene)acetate.
Molecular Properties
| Compound Name | methyl 2-(3-butan-2-yl-1-oxo-2,3-dihydroisoquinolin-4-ylidene)acetate |
| PubChem CID | 73049977 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | methyl 2-(3-butan-2-yl-1-oxo-2,3-dihydroisoquinolin-4-ylidene)acetate |
| SMILES | CCC(C)C1NC(=O)c2ccccc2C1=CC(=O)OC |
| InChI | InChI=1S/C16H19NO3/c1-4-10(2)15-13(9-14(18)20-3)11-7-5-6-8-12(11)16(19)17-15/h5-10,15H,4H2,1-3H3,(H,17,19) |
| InChIKey | WTOZPXCEAVDNDP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(3-butan-2-yl-1-oxo-2,3-dihydroisoquinolin-4-ylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3-butan-2-yl-1-oxo-2,3-dihydroisoquinolin-4-ylidene)acetate?
The IUPAC name of methyl 2-(3-butan-2-yl-1-oxo-2,3-dihydroisoquinolin-4-ylidene)acetate (CID 73049977) is methyl 2-(3-butan-2-yl-1-oxo-2,3-dihydroisoquinolin-4-ylidene)acetate.
What is the SMILES notation for methyl 2-(3-butan-2-yl-1-oxo-2,3-dihydroisoquinolin-4-ylidene)acetate?
The canonical SMILES for methyl 2-(3-butan-2-yl-1-oxo-2,3-dihydroisoquinolin-4-ylidene)acetate is CCC(C)C1NC(=O)c2ccccc2C1=CC(=O)OC.
What is the InChIKey of methyl 2-(3-butan-2-yl-1-oxo-2,3-dihydroisoquinolin-4-ylidene)acetate?
The InChIKey is WTOZPXCEAVDNDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO3/c1-4-10(2)15-13(9-14(18)20-3)11-7-5-6-8-12(11)16(19)17-15/h5-10,15H,4H2,1-3H3,(H,17,19).
What are the key properties of methyl 2-(3-butan-2-yl-1-oxo-2,3-dihydroisoquinolin-4-ylidene)acetate?
methyl 2-(3-butan-2-yl-1-oxo-2,3-dihydroisoquinolin-4-ylidene)acetate has a molecular weight of 273.33 g/mol, XLogP of 2.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-butan-2-yl-1-oxo-2,3-dihydroisoquinolin-4-ylidene)acetate is sourced from PubChem (CID 73049977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).