C14H20BrNO2 — CID 73050129
tert-butyl 8-bromo-10-azabicyclo[4.3.1]deca-3,7-diene-10-carboxylate (PubChem CID 73050129) has the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. Its IUPAC name is tert-butyl 8-bromo-10-azabicyclo[4.3.1]deca-3,7-diene-10-carboxylate.
| Compound Name | tert-butyl 8-bromo-10-azabicyclo[4.3.1]deca-3,7-diene-10-carboxylate |
|---|---|
| PubChem CID | 73050129 |
| Molecular Formula | C14H20BrNO2 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | tert-butyl 8-bromo-10-azabicyclo[4.3.1]deca-3,7-diene-10-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2C=C(Br)CC1CC=CC2 |
| InChI | InChI=1S/C14H20BrNO2/c1-14(2,3)18-13(17)16-11-6-4-5-7-12(16)9-10(15)8-11/h4-5,8,11-12H,6-7,9H2,1-3H3 |
| InChIKey | ITSWGNJOCQICLD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|