About tert-butyl 8-bromo-10-azabicyclo[4.3.1]deca-3,7-diene-10-carboxylate
tert-butyl 8-bromo-10-azabicyclo[4.3.1]deca-3,7-diene-10-carboxylate (PubChem CID 73050129) has the molecular formula C14H20BrNO2
and a molecular weight of 314.22 g/mol. Its IUPAC name is tert-butyl 8-bromo-10-azabicyclo[4.3.1]deca-3,7-diene-10-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 8-bromo-10-azabicyclo[4.3.1]deca-3,7-diene-10-carboxylate |
| PubChem CID | 73050129 |
| Molecular Formula | C14H20BrNO2 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | tert-butyl 8-bromo-10-azabicyclo[4.3.1]deca-3,7-diene-10-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2C=C(Br)CC1CC=CC2 |
| InChI | InChI=1S/C14H20BrNO2/c1-14(2,3)18-13(17)16-11-6-4-5-7-12(16)9-10(15)8-11/h4-5,8,11-12H,6-7,9H2,1-3H3 |
| InChIKey | ITSWGNJOCQICLD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 8-bromo-10-azabicyclo[4.3.1]deca-3,7-diene-10-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 8-bromo-10-azabicyclo[4.3.1]deca-3,7-diene-10-carboxylate?
The IUPAC name of tert-butyl 8-bromo-10-azabicyclo[4.3.1]deca-3,7-diene-10-carboxylate (CID 73050129) is tert-butyl 8-bromo-10-azabicyclo[4.3.1]deca-3,7-diene-10-carboxylate.
What is the SMILES notation for tert-butyl 8-bromo-10-azabicyclo[4.3.1]deca-3,7-diene-10-carboxylate?
The canonical SMILES for tert-butyl 8-bromo-10-azabicyclo[4.3.1]deca-3,7-diene-10-carboxylate is CC(C)(C)OC(=O)N1C2C=C(Br)CC1CC=CC2.
What is the InChIKey of tert-butyl 8-bromo-10-azabicyclo[4.3.1]deca-3,7-diene-10-carboxylate?
The InChIKey is ITSWGNJOCQICLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20BrNO2/c1-14(2,3)18-13(17)16-11-6-4-5-7-12(16)9-10(15)8-11/h4-5,8,11-12H,6-7,9H2,1-3H3.
What are the key properties of tert-butyl 8-bromo-10-azabicyclo[4.3.1]deca-3,7-diene-10-carboxylate?
tert-butyl 8-bromo-10-azabicyclo[4.3.1]deca-3,7-diene-10-carboxylate has a molecular weight of 314.22 g/mol, XLogP of 3.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 8-bromo-10-azabicyclo[4.3.1]deca-3,7-diene-10-carboxylate is sourced from PubChem (CID 73050129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).