C20H20N2O4S — CID 73050497
5-[[3-(3-oxo-3-piperidin-1-ylpropyl)-1-benzofuran-5-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 73050497) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 5-[[3-(3-oxo-3-piperidin-1-ylpropyl)-1-benzofuran-5-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-(3-oxo-3-piperidin-1-ylpropyl)-1-benzofuran-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 73050497 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 5-[[3-(3-oxo-3-piperidin-1-ylpropyl)-1-benzofuran-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccc3occ(CCC(=O)N4CCCCC4)c3c2)S1 |
| InChI | InChI=1S/C20H20N2O4S/c23-18(22-8-2-1-3-9-22)7-5-14-12-26-16-6-4-13(10-15(14)16)11-17-19(24)21-20(25)27-17/h4,6,10-12H,1-3,5,7-9H2,(H,21,24,25) |
| InChIKey | WRRMZUCLGGPBGP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|