C30H28ClF2N3O3 — CID 73050941
(10R,14S)-14-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-5-methoxy-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-9-one (PubChem CID 73050941) has the molecular formula C30H28ClF2N3O3 and a molecular weight of 552.02 g/mol. Its IUPAC name is (10R,14S)-14-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-5-methoxy-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-9-one.
| Compound Name | (10R,14S)-14-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-5-methoxy-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-9-one |
|---|---|
| PubChem CID | 73050941 |
| Molecular Formula | C30H28ClF2N3O3 |
| Molecular Weight | 552.02 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | (10R,14S)-14-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-5-methoxy-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-9-one |
| SMILES | COc1ccc2c(c1)NC(=O)[C@H](C)CCC[C@H](N1CCC(c3c(F)ccc(Cl)c3F)=CC1=O)c1cc-2ccn1 |
| InChI | InChI=1S/C30H28ClF2N3O3/c1-17-4-3-5-26(36-13-11-19(15-27(36)37)28-23(32)9-8-22(31)29(28)33)25-14-18(10-12-34-25)21-7-6-20(39-2)16-24(21)35-30(17)38/h6-10,12,14-17,26H,3-5,11,13H2,1-2H3,(H,35,38)/t17-,26+/m1/s1 |
| InChIKey | BFURPWNKSPOHBU-QUGAMOGWSA-N |
| XLogP | 6.80 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.02 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|