About 5-[2-(2,4-difluorophenyl)pyrazol-3-yl]-3-(4-methoxyphenyl)-2,1-benzoxazole
5-[2-(2,4-difluorophenyl)pyrazol-3-yl]-3-(4-methoxyphenyl)-2,1-benzoxazole (PubChem CID 73050959) has the molecular formula C23H15F2N3O2
and a molecular weight of 403.39 g/mol. Its IUPAC name is 5-[2-(2,4-difluorophenyl)pyrazol-3-yl]-3-(4-methoxyphenyl)-2,1-benzoxazole.
Molecular Properties
| Compound Name | 5-[2-(2,4-difluorophenyl)pyrazol-3-yl]-3-(4-methoxyphenyl)-2,1-benzoxazole |
| PubChem CID | 73050959 |
| Molecular Formula | C23H15F2N3O2 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 5-[2-(2,4-difluorophenyl)pyrazol-3-yl]-3-(4-methoxyphenyl)-2,1-benzoxazole |
| SMILES | COc1ccc(-c2onc3ccc(-c4ccnn4-c4ccc(F)cc4F)cc23)cc1 |
| InChI | InChI=1S/C23H15F2N3O2/c1-29-17-6-2-14(3-7-17)23-18-12-15(4-8-20(18)27-30-23)21-10-11-26-28(21)22-9-5-16(24)13-19(22)25/h2-13H,1H3 |
| InChIKey | MJULSZPSCBQPMD-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2-(2,4-difluorophenyl)pyrazol-3-yl]-3-(4-methoxyphenyl)-2,1-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2,4-difluorophenyl)pyrazol-3-yl]-3-(4-methoxyphenyl)-2,1-benzoxazole?
The IUPAC name of 5-[2-(2,4-difluorophenyl)pyrazol-3-yl]-3-(4-methoxyphenyl)-2,1-benzoxazole (CID 73050959) is 5-[2-(2,4-difluorophenyl)pyrazol-3-yl]-3-(4-methoxyphenyl)-2,1-benzoxazole.
What is the SMILES notation for 5-[2-(2,4-difluorophenyl)pyrazol-3-yl]-3-(4-methoxyphenyl)-2,1-benzoxazole?
The canonical SMILES for 5-[2-(2,4-difluorophenyl)pyrazol-3-yl]-3-(4-methoxyphenyl)-2,1-benzoxazole is COc1ccc(-c2onc3ccc(-c4ccnn4-c4ccc(F)cc4F)cc23)cc1.
What is the InChIKey of 5-[2-(2,4-difluorophenyl)pyrazol-3-yl]-3-(4-methoxyphenyl)-2,1-benzoxazole?
The InChIKey is MJULSZPSCBQPMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15F2N3O2/c1-29-17-6-2-14(3-7-17)23-18-12-15(4-8-20(18)27-30-23)21-10-11-26-28(21)22-9-5-16(24)13-19(22)25/h2-13H,1H3.
What are the key properties of 5-[2-(2,4-difluorophenyl)pyrazol-3-yl]-3-(4-methoxyphenyl)-2,1-benzoxazole?
5-[2-(2,4-difluorophenyl)pyrazol-3-yl]-3-(4-methoxyphenyl)-2,1-benzoxazole has a molecular weight of 403.39 g/mol, XLogP of 5.63, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2,4-difluorophenyl)pyrazol-3-yl]-3-(4-methoxyphenyl)-2,1-benzoxazole is sourced from PubChem (CID 73050959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).