C31H32Cl3N5OS — CID 73051231
4-chloro-1-[2-[[5-(3,5-dichlorophenyl)-1,3,4-thiadiazol-2-yl]amino]phenyl]-1'-(2,2-dimethylpropyl)spiro[2H-indole-3,4'-piperidine]-7-ol (PubChem CID 73051231) has the molecular formula C31H32Cl3N5OS and a molecular weight of 629.06 g/mol. Its IUPAC name is 4-chloro-1-[2-[[5-(3,5-dichlorophenyl)-1,3,4-thiadiazol-2-yl]amino]phenyl]-1'-(2,2-dimethylpropyl)spiro[2H-indole-3,4'-piperidine]-7-ol.
| Compound Name | 4-chloro-1-[2-[[5-(3,5-dichlorophenyl)-1,3,4-thiadiazol-2-yl]amino]phenyl]-1'-(2,2-dimethylpropyl)spiro[2H-indole-3,4'-piperidine]-7-ol |
|---|---|
| PubChem CID | 73051231 |
| Molecular Formula | C31H32Cl3N5OS |
| Molecular Weight | 629.06 g/mol |
| Exact Mass | 627.14 |
| IUPAC Name | 4-chloro-1-[2-[[5-(3,5-dichlorophenyl)-1,3,4-thiadiazol-2-yl]amino]phenyl]-1'-(2,2-dimethylpropyl)spiro[2H-indole-3,4'-piperidine]-7-ol |
| SMILES | CC(C)(C)CN1CCC2(CC1)CN(c1ccccc1Nc1nnc(-c3cc(Cl)cc(Cl)c3)s1)c1c(O)ccc(Cl)c12 |
| InChI | InChI=1S/C31H32Cl3N5OS/c1-30(2,3)17-38-12-10-31(11-13-38)18-39(27-25(40)9-8-22(34)26(27)31)24-7-5-4-6-23(24)35-29-37-36-28(41-29)19-14-20(32)16-21(33)15-19/h4-9,14-16,40H,10-13,17-18H2,1-3H3,(H,35,37) |
| InChIKey | XPWCOSPDTFZVFE-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.06 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |