C25H17F3N4O3 — CID 73051331
3-[[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]methylcarbamoylamino]benzoic acid (PubChem CID 73051331) has the molecular formula C25H17F3N4O3 and a molecular weight of 478.43 g/mol. Its IUPAC name is 3-[[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]methylcarbamoylamino]benzoic acid.
| Compound Name | 3-[[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]methylcarbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 73051331 |
| Molecular Formula | C25H17F3N4O3 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 3-[[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]methylcarbamoylamino]benzoic acid |
| SMILES | O=C(NCc1nc2ccccn2c1C#Cc1cccc(C(F)(F)F)c1)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H17F3N4O3/c26-25(27,28)18-7-3-5-16(13-18)10-11-21-20(31-22-9-1-2-12-32(21)22)15-29-24(35)30-19-8-4-6-17(14-19)23(33)34/h1-9,12-14H,15H2,(H,33,34)(H2,29,30,35) |
| InChIKey | IXFMLNMXLGLLDT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|