C34H29ClF2N6O — CID 73051392
(3E,5E)-1-[[1-[3-[(7-chloroquinolin-4-yl)amino]propyl]triazol-4-yl]methyl]-3,5-bis[(4-fluorophenyl)methylidene]piperidin-4-one (PubChem CID 73051392) has the molecular formula C34H29ClF2N6O and a molecular weight of 611.10 g/mol. Its IUPAC name is (3E,5E)-1-[[1-[3-[(7-chloroquinolin-4-yl)amino]propyl]triazol-4-yl]methyl]-3,5-bis[(4-fluorophenyl)methylidene]piperidin-4-one.
| Compound Name | (3E,5E)-1-[[1-[3-[(7-chloroquinolin-4-yl)amino]propyl]triazol-4-yl]methyl]-3,5-bis[(4-fluorophenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 73051392 |
| Molecular Formula | C34H29ClF2N6O |
| Molecular Weight | 611.10 g/mol |
| Exact Mass | 610.21 |
| IUPAC Name | (3E,5E)-1-[[1-[3-[(7-chloroquinolin-4-yl)amino]propyl]triazol-4-yl]methyl]-3,5-bis[(4-fluorophenyl)methylidene]piperidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(F)cc2)CN(Cc2cn(CCCNc3ccnc4cc(Cl)ccc34)nn2)C/C1=C\c1ccc(F)cc1 |
| InChI | InChI=1S/C34H29ClF2N6O/c35-27-6-11-31-32(12-14-39-33(31)18-27)38-13-1-15-43-22-30(40-41-43)21-42-19-25(16-23-2-7-28(36)8-3-23)34(44)26(20-42)17-24-4-9-29(37)10-5-24/h2-12,14,16-18,22H,1,13,15,19-21H2,(H,38,39)/b25-16+,26-17+ |
| InChIKey | HXXMJRXSYQKHIE-ZZZAPRPPSA-N |
| XLogP | 6.81 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.10 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|