C26H19F3N4O3S2 — CID 73051786
[(4aR)-6-(3,4-difluorophenyl)sulfonyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone (PubChem CID 73051786) has the molecular formula C26H19F3N4O3S2 and a molecular weight of 556.59 g/mol. Its IUPAC name is [(4aR)-6-(3,4-difluorophenyl)sulfonyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone.
| Compound Name | [(4aR)-6-(3,4-difluorophenyl)sulfonyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 73051786 |
| Molecular Formula | C26H19F3N4O3S2 |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.09 |
| IUPAC Name | [(4aR)-6-(3,4-difluorophenyl)sulfonyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone |
| SMILES | O=C(c1nccs1)[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCN(S(=O)(=O)c1ccc(F)c(F)c1)C2 |
| InChI | InChI=1S/C26H19F3N4O3S2/c27-18-1-3-19(4-2-18)33-23-11-17-7-9-32(38(35,36)20-5-6-21(28)22(29)12-20)15-26(17,13-16(23)14-31-33)24(34)25-30-8-10-37-25/h1-6,8,10-12,14H,7,9,13,15H2/t26-/m0/s1 |
| InChIKey | SKSXFFSIYMFQNH-SANMLTNESA-N |
| XLogP | 4.65 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |