About (1S)-1-(1H-1,2,4-triazol-5-yl)but-3-yn-1-amine
(1S)-1-(1H-1,2,4-triazol-5-yl)but-3-yn-1-amine (PubChem CID 73051824) has the molecular formula C6H8N4
and a molecular weight of 136.16 g/mol. Its IUPAC name is (1S)-1-(1H-1,2,4-triazol-5-yl)but-3-yn-1-amine.
Molecular Properties
| Compound Name | (1S)-1-(1H-1,2,4-triazol-5-yl)but-3-yn-1-amine |
| PubChem CID | 73051824 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | (1S)-1-(1H-1,2,4-triazol-5-yl)but-3-yn-1-amine |
| SMILES | C#CC[C@H](N)c1ncn[nH]1 |
| InChI | InChI=1S/C6H8N4/c1-2-3-5(7)6-8-4-9-10-6/h1,4-5H,3,7H2,(H,8,9,10)/t5-/m0/s1 |
| InChIKey | BAPGLPCYDLMCAY-YFKPBYRVSA-N |
| XLogP | -0.17 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-(1H-1,2,4-triazol-5-yl)but-3-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(1H-1,2,4-triazol-5-yl)but-3-yn-1-amine?
The IUPAC name of (1S)-1-(1H-1,2,4-triazol-5-yl)but-3-yn-1-amine (CID 73051824) is (1S)-1-(1H-1,2,4-triazol-5-yl)but-3-yn-1-amine.
What is the SMILES notation for (1S)-1-(1H-1,2,4-triazol-5-yl)but-3-yn-1-amine?
The canonical SMILES for (1S)-1-(1H-1,2,4-triazol-5-yl)but-3-yn-1-amine is C#CC[C@H](N)c1ncn[nH]1.
What is the InChIKey of (1S)-1-(1H-1,2,4-triazol-5-yl)but-3-yn-1-amine?
The InChIKey is BAPGLPCYDLMCAY-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H8N4/c1-2-3-5(7)6-8-4-9-10-6/h1,4-5H,3,7H2,(H,8,9,10)/t5-/m0/s1.
What are the key properties of (1S)-1-(1H-1,2,4-triazol-5-yl)but-3-yn-1-amine?
(1S)-1-(1H-1,2,4-triazol-5-yl)but-3-yn-1-amine has a molecular weight of 136.16 g/mol, XLogP of -0.17, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(1H-1,2,4-triazol-5-yl)but-3-yn-1-amine is sourced from PubChem (CID 73051824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).