C11H9F3N4O2 — CID 73051905
(E)-3-[4-(2,2,2-trifluoroethoxy)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-enamide (PubChem CID 73051905) has the molecular formula C11H9F3N4O2 and a molecular weight of 286.21 g/mol. Its IUPAC name is (E)-3-[4-(2,2,2-trifluoroethoxy)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-enamide.
| Compound Name | (E)-3-[4-(2,2,2-trifluoroethoxy)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 73051905 |
| Molecular Formula | C11H9F3N4O2 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | (E)-3-[4-(2,2,2-trifluoroethoxy)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-enamide |
| SMILES | NC(=O)/C=C/c1c[nH]c2ncnc(OCC(F)(F)F)c12 |
| InChI | InChI=1S/C11H9F3N4O2/c12-11(13,14)4-20-10-8-6(1-2-7(15)19)3-16-9(8)17-5-18-10/h1-3,5H,4H2,(H2,15,19)(H,16,17,18)/b2-1+ |
| InChIKey | BKXGJUGZEFIAJO-OWOJBTEDSA-N |
| XLogP | 1.40 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|