C20H8O6S — CID 73052318
6,17-dihydroxy-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15(20),16,18-octaene-3,10,14,21-tetrone (PubChem CID 73052318) has the molecular formula C20H8O6S and a molecular weight of 376.35 g/mol. Its IUPAC name is 6,17-dihydroxy-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15(20),16,18-octaene-3,10,14,21-tetrone.
| Compound Name | 6,17-dihydroxy-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15(20),16,18-octaene-3,10,14,21-tetrone |
|---|---|
| PubChem CID | 73052318 |
| Molecular Formula | C20H8O6S |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | 6,17-dihydroxy-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15(20),16,18-octaene-3,10,14,21-tetrone |
| SMILES | O=c1c2cc(O)ccc2c(=O)c2c1sc1c(=O)c3ccc(O)cc3c(=O)c12 |
| InChI | InChI=1S/C20H8O6S/c21-7-2-4-10-11(5-7)16(24)14-13-15(23)9-3-1-8(22)6-12(9)18(26)20(13)27-19(14)17(10)25/h1-6,21-22H |
| InChIKey | VAWRQNDCSSUCAG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|