C22H22N2O6 — CID 73053165
2-[[4-hydroxy-1-[[4-(2-methylphenoxy)phenyl]methyl]-6-oxo-2,3-dihydropyridine-5-carbonyl]amino]acetic acid (PubChem CID 73053165) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-[[4-hydroxy-1-[[4-(2-methylphenoxy)phenyl]methyl]-6-oxo-2,3-dihydropyridine-5-carbonyl]amino]acetic acid.
| Compound Name | 2-[[4-hydroxy-1-[[4-(2-methylphenoxy)phenyl]methyl]-6-oxo-2,3-dihydropyridine-5-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 73053165 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-[[4-hydroxy-1-[[4-(2-methylphenoxy)phenyl]methyl]-6-oxo-2,3-dihydropyridine-5-carbonyl]amino]acetic acid |
| SMILES | Cc1ccccc1Oc1ccc(CN2CCC(O)=C(C(=O)NCC(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C22H22N2O6/c1-14-4-2-3-5-18(14)30-16-8-6-15(7-9-16)13-24-11-10-17(25)20(22(24)29)21(28)23-12-19(26)27/h2-9,25H,10-13H2,1H3,(H,23,28)(H,26,27) |
| InChIKey | LMIJTFUGUBSGGE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|