C21H14F4N4O5 — CID 73053990
N-[(4S)-4-[3-fluoro-4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-yl]-5-nitropyridine-2-carboxamide (PubChem CID 73053990) has the molecular formula C21H14F4N4O5 and a molecular weight of 478.36 g/mol. Its IUPAC name is N-[(4S)-4-[3-fluoro-4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-yl]-5-nitropyridine-2-carboxamide.
| Compound Name | N-[(4S)-4-[3-fluoro-4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-yl]-5-nitropyridine-2-carboxamide |
|---|---|
| PubChem CID | 73053990 |
| Molecular Formula | C21H14F4N4O5 |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | N-[(4S)-4-[3-fluoro-4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-yl]-5-nitropyridine-2-carboxamide |
| SMILES | O=C(N[C@]1(c2ccc(OC(F)(F)F)c(F)c2)CCOc2cccnc21)c1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C21H14F4N4O5/c22-14-10-12(3-6-16(14)34-21(23,24)25)20(7-9-33-17-2-1-8-26-18(17)20)28-19(30)15-5-4-13(11-27-15)29(31)32/h1-6,8,10-11H,7,9H2,(H,28,30)/t20-/m0/s1 |
| InChIKey | ZPEVYACNQWYLKR-FQEVSTJZSA-N |
| XLogP | 3.88 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|