C20H26O6 — CID 73054320
(1R,2S,3R,6S,8S)-3-ethenyl-11-(2-methoxy-2-oxoethyl)-3,7,7-trimethyl-9-oxo-10-oxatricyclo[6.2.2.01,6]dodec-11-ene-2-carboxylic acid (PubChem CID 73054320) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is (1R,2S,3R,6S,8S)-3-ethenyl-11-(2-methoxy-2-oxoethyl)-3,7,7-trimethyl-9-oxo-10-oxatricyclo[6.2.2.01,6]dodec-11-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3R,6S,8S)-3-ethenyl-11-(2-methoxy-2-oxoethyl)-3,7,7-trimethyl-9-oxo-10-oxatricyclo[6.2.2.01,6]dodec-11-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 73054320 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (1R,2S,3R,6S,8S)-3-ethenyl-11-(2-methoxy-2-oxoethyl)-3,7,7-trimethyl-9-oxo-10-oxatricyclo[6.2.2.01,6]dodec-11-ene-2-carboxylic acid |
| SMILES | C=C[C@@]1(C)CC[C@H]2C(C)(C)[C@@H]3C=C(CC(=O)OC)[C@]2(OC3=O)[C@H]1C(=O)O |
| InChI | InChI=1S/C20H26O6/c1-6-19(4)8-7-13-18(2,3)12-9-11(10-14(21)25-5)20(13,26-17(12)24)15(19)16(22)23/h6,9,12-13,15H,1,7-8,10H2,2-5H3,(H,22,23)/t12-,13+,15+,19+,20-/m1/s1 |
| InChIKey | LZDCVIUKAHOBOO-RTPXSMORSA-N |
| XLogP | 2.73 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|