C43H44N4O9 — CID 73054622
benzyl N-[(2R,4R)-1-hydroxy-5-phenyl-4-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]pentan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate (PubChem CID 73054622) has the molecular formula C43H44N4O9 and a molecular weight of 760.84 g/mol. Its IUPAC name is benzyl N-[(2R,4R)-1-hydroxy-5-phenyl-4-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]pentan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate.
| Compound Name | benzyl N-[(2R,4R)-1-hydroxy-5-phenyl-4-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]pentan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 73054622 |
| Molecular Formula | C43H44N4O9 |
| Molecular Weight | 760.84 g/mol |
| Exact Mass | 760.31 |
| IUPAC Name | benzyl N-[(2R,4R)-1-hydroxy-5-phenyl-4-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]pentan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate |
| SMILES | O=C(NN(C(=O)OCc1ccccc1)[C@H](Cc1ccccc1)C[C@H](CO)N(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C43H44N4O9/c48-28-39(47(43(52)56-32-37-24-14-5-15-25-37)45-41(50)54-30-35-20-10-3-11-21-35)27-38(26-33-16-6-1-7-17-33)46(42(51)55-31-36-22-12-4-13-23-36)44-40(49)53-29-34-18-8-2-9-19-34/h1-25,38-39,48H,26-32H2,(H,44,49)(H,45,50)/t38-,39-/m1/s1 |
| InChIKey | KWWJTEVSFCNGEN-LJEWAXOPSA-N |
| XLogP | 7.31 |
| TPSA | 155.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.84 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|