C31H54O5SSi — CID 73054699
(5S)-3-[(2R,13R)-2-[tert-butyl(dimethyl)silyl]oxy-13,14-dihydroxytetradecyl]-5-methyl-3-phenylsulfanyloxolan-2-one (PubChem CID 73054699) has the molecular formula C31H54O5SSi and a molecular weight of 566.92 g/mol. Its IUPAC name is (5S)-3-[(2R,13R)-2-[tert-butyl(dimethyl)silyl]oxy-13,14-dihydroxytetradecyl]-5-methyl-3-phenylsulfanyloxolan-2-one.
| Compound Name | (5S)-3-[(2R,13R)-2-[tert-butyl(dimethyl)silyl]oxy-13,14-dihydroxytetradecyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 73054699 |
| Molecular Formula | C31H54O5SSi |
| Molecular Weight | 566.92 g/mol |
| Exact Mass | 566.35 |
| IUPAC Name | (5S)-3-[(2R,13R)-2-[tert-butyl(dimethyl)silyl]oxy-13,14-dihydroxytetradecyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
| SMILES | C[C@H]1CC(C[C@@H](CCCCCCCCCC[C@@H](O)CO)O[Si](C)(C)C(C)(C)C)(Sc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C31H54O5SSi/c1-25-22-31(29(34)35-25,37-28-20-16-13-17-21-28)23-27(36-38(5,6)30(2,3)4)19-15-12-10-8-7-9-11-14-18-26(33)24-32/h13,16-17,20-21,25-27,32-33H,7-12,14-15,18-19,22-24H2,1-6H3/t25-,26+,27+,31?/m0/s1 |
| InChIKey | XROPKRFQXIHLDR-SWPWINHYSA-N |
| XLogP | 7.89 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.92 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|