C22H14ClN3O4 — CID 73054744
(3S,4'R)-7-chloro-3'-(4-nitrophenyl)-4'-phenylspiro[1H-indole-3,5'-4H-1,2-oxazole]-2-one (PubChem CID 73054744) has the molecular formula C22H14ClN3O4 and a molecular weight of 419.82 g/mol. Its IUPAC name is (3S,4'R)-7-chloro-3'-(4-nitrophenyl)-4'-phenylspiro[1H-indole-3,5'-4H-1,2-oxazole]-2-one.
| Compound Name | (3S,4'R)-7-chloro-3'-(4-nitrophenyl)-4'-phenylspiro[1H-indole-3,5'-4H-1,2-oxazole]-2-one |
|---|---|
| PubChem CID | 73054744 |
| Molecular Formula | C22H14ClN3O4 |
| Molecular Weight | 419.82 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | (3S,4'R)-7-chloro-3'-(4-nitrophenyl)-4'-phenylspiro[1H-indole-3,5'-4H-1,2-oxazole]-2-one |
| SMILES | O=C1Nc2c(Cl)cccc2[C@]12ON=C(c1ccc([N+](=O)[O-])cc1)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C22H14ClN3O4/c23-17-8-4-7-16-20(17)24-21(27)22(16)18(13-5-2-1-3-6-13)19(25-30-22)14-9-11-15(12-10-14)26(28)29/h1-12,18H,(H,24,27)/t18-,22-/m1/s1 |
| InChIKey | IFASJWGRLHHJIO-XMSQKQJNSA-N |
| XLogP | 4.61 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.82 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|