About [3-[2-fluoro-4-(1-hydroxypropan-2-yl)phenyl]phenyl] N-hexylcarbamate
[3-[2-fluoro-4-(1-hydroxypropan-2-yl)phenyl]phenyl] N-hexylcarbamate (PubChem CID 73054809) has the molecular formula C22H28FNO3
and a molecular weight of 373.47 g/mol. Its IUPAC name is [3-[2-fluoro-4-(1-hydroxypropan-2-yl)phenyl]phenyl] N-hexylcarbamate.
Molecular Properties
| Compound Name | [3-[2-fluoro-4-(1-hydroxypropan-2-yl)phenyl]phenyl] N-hexylcarbamate |
| PubChem CID | 73054809 |
| Molecular Formula | C22H28FNO3 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | [3-[2-fluoro-4-(1-hydroxypropan-2-yl)phenyl]phenyl] N-hexylcarbamate |
| SMILES | CCCCCCNC(=O)Oc1cccc(-c2ccc(C(C)CO)cc2F)c1 |
| InChI | InChI=1S/C22H28FNO3/c1-3-4-5-6-12-24-22(26)27-19-9-7-8-18(13-19)20-11-10-17(14-21(20)23)16(2)15-25/h7-11,13-14,16,25H,3-6,12,15H2,1-2H3,(H,24,26) |
| InChIKey | WGAHHJUZFSFTHU-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-[2-fluoro-4-(1-hydroxypropan-2-yl)phenyl]phenyl] N-hexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-fluoro-4-(1-hydroxypropan-2-yl)phenyl]phenyl] N-hexylcarbamate?
The IUPAC name of [3-[2-fluoro-4-(1-hydroxypropan-2-yl)phenyl]phenyl] N-hexylcarbamate (CID 73054809) is [3-[2-fluoro-4-(1-hydroxypropan-2-yl)phenyl]phenyl] N-hexylcarbamate.
What is the SMILES notation for [3-[2-fluoro-4-(1-hydroxypropan-2-yl)phenyl]phenyl] N-hexylcarbamate?
The canonical SMILES for [3-[2-fluoro-4-(1-hydroxypropan-2-yl)phenyl]phenyl] N-hexylcarbamate is CCCCCCNC(=O)Oc1cccc(-c2ccc(C(C)CO)cc2F)c1.
What is the InChIKey of [3-[2-fluoro-4-(1-hydroxypropan-2-yl)phenyl]phenyl] N-hexylcarbamate?
The InChIKey is WGAHHJUZFSFTHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28FNO3/c1-3-4-5-6-12-24-22(26)27-19-9-7-8-18(13-19)20-11-10-17(14-21(20)23)16(2)15-25/h7-11,13-14,16,25H,3-6,12,15H2,1-2H3,(H,24,26).
What are the key properties of [3-[2-fluoro-4-(1-hydroxypropan-2-yl)phenyl]phenyl] N-hexylcarbamate?
[3-[2-fluoro-4-(1-hydroxypropan-2-yl)phenyl]phenyl] N-hexylcarbamate has a molecular weight of 373.47 g/mol, XLogP of 5.26, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-fluoro-4-(1-hydroxypropan-2-yl)phenyl]phenyl] N-hexylcarbamate is sourced from PubChem (CID 73054809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).