C22H26FNO4 — CID 73055092
2-[3-fluoro-4-[3-(hexoxycarbonylamino)phenyl]phenyl]propanoic acid (PubChem CID 73055092) has the molecular formula C22H26FNO4 and a molecular weight of 387.45 g/mol. Its IUPAC name is 2-[3-fluoro-4-[3-(hexoxycarbonylamino)phenyl]phenyl]propanoic acid.
| Compound Name | 2-[3-fluoro-4-[3-(hexoxycarbonylamino)phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 73055092 |
| Molecular Formula | C22H26FNO4 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-[3-fluoro-4-[3-(hexoxycarbonylamino)phenyl]phenyl]propanoic acid |
| SMILES | CCCCCCOC(=O)Nc1cccc(-c2ccc(C(C)C(=O)O)cc2F)c1 |
| InChI | InChI=1S/C22H26FNO4/c1-3-4-5-6-12-28-22(27)24-18-9-7-8-17(13-18)19-11-10-16(14-20(19)23)15(2)21(25)26/h7-11,13-15H,3-6,12H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | XZUBHAPSWGFXBW-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|