About 2,6-bis(4-fluorophenyl)-3,5-diiodo-1-propylpyridin-4-one
2,6-bis(4-fluorophenyl)-3,5-diiodo-1-propylpyridin-4-one (PubChem CID 73055765) has the molecular formula C20H15F2I2NO
and a molecular weight of 577.15 g/mol. Its IUPAC name is 2,6-bis(4-fluorophenyl)-3,5-diiodo-1-propylpyridin-4-one.
Molecular Properties
| Compound Name | 2,6-bis(4-fluorophenyl)-3,5-diiodo-1-propylpyridin-4-one |
| PubChem CID | 73055765 |
| Molecular Formula | C20H15F2I2NO |
| Molecular Weight | 577.15 g/mol |
| Exact Mass | 576.92 |
| IUPAC Name | 2,6-bis(4-fluorophenyl)-3,5-diiodo-1-propylpyridin-4-one |
| SMILES | CCCn1c(-c2ccc(F)cc2)c(I)c(=O)c(I)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H15F2I2NO/c1-2-11-25-18(12-3-7-14(21)8-4-12)16(23)20(26)17(24)19(25)13-5-9-15(22)10-6-13/h3-10H,2,11H2,1H3 |
| InChIKey | ZEPHRTLQSJWIHT-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 577.15 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,6-bis(4-fluorophenyl)-3,5-diiodo-1-propylpyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(4-fluorophenyl)-3,5-diiodo-1-propylpyridin-4-one?
The IUPAC name of 2,6-bis(4-fluorophenyl)-3,5-diiodo-1-propylpyridin-4-one (CID 73055765) is 2,6-bis(4-fluorophenyl)-3,5-diiodo-1-propylpyridin-4-one.
What is the SMILES notation for 2,6-bis(4-fluorophenyl)-3,5-diiodo-1-propylpyridin-4-one?
The canonical SMILES for 2,6-bis(4-fluorophenyl)-3,5-diiodo-1-propylpyridin-4-one is CCCn1c(-c2ccc(F)cc2)c(I)c(=O)c(I)c1-c1ccc(F)cc1.
What is the InChIKey of 2,6-bis(4-fluorophenyl)-3,5-diiodo-1-propylpyridin-4-one?
The InChIKey is ZEPHRTLQSJWIHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F2I2NO/c1-2-11-25-18(12-3-7-14(21)8-4-12)16(23)20(26)17(24)19(25)13-5-9-15(22)10-6-13/h3-10H,2,11H2,1H3.
What are the key properties of 2,6-bis(4-fluorophenyl)-3,5-diiodo-1-propylpyridin-4-one?
2,6-bis(4-fluorophenyl)-3,5-diiodo-1-propylpyridin-4-one has a molecular weight of 577.15 g/mol, XLogP of 6.08, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(4-fluorophenyl)-3,5-diiodo-1-propylpyridin-4-one is sourced from PubChem (CID 73055765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).