C37H53BrO4 — CID 73055915
(4-bromophenyl)methyl (4aS,6aR,6aS,6bR,8aR,10R,11R,12aR,14bS)-10,11-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate (PubChem CID 73055915) has the molecular formula C37H53BrO4 and a molecular weight of 641.73 g/mol. Its IUPAC name is (4-bromophenyl)methyl (4aS,6aR,6aS,6bR,8aR,10R,11R,12aR,14bS)-10,11-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate.
| Compound Name | (4-bromophenyl)methyl (4aS,6aR,6aS,6bR,8aR,10R,11R,12aR,14bS)-10,11-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 73055915 |
| Molecular Formula | C37H53BrO4 |
| Molecular Weight | 641.73 g/mol |
| Exact Mass | 640.31 |
| IUPAC Name | (4-bromophenyl)methyl (4aS,6aR,6aS,6bR,8aR,10R,11R,12aR,14bS)-10,11-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
| SMILES | CC1(C)CC[C@]2(C(=O)OCc3ccc(Br)cc3)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](O)[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C37H53BrO4/c1-32(2)16-18-37(31(41)42-22-23-8-10-24(38)11-9-23)19-17-35(6)25(26(37)20-32)12-13-29-34(5)21-27(39)30(40)33(3,4)28(34)14-15-36(29,35)7/h8-12,26-30,39-40H,13-22H2,1-7H3/t26-,27+,28-,29+,30-,34-,35+,36+,37-/m0/s1 |
| InChIKey | WUNQOHRFNWYXSP-IOSPBWAASA-N |
| XLogP | 8.63 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.73 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|