C26H40N2OS — CID 73056177
N-(4-aminobutyl)-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzamide (PubChem CID 73056177) has the molecular formula C26H40N2OS and a molecular weight of 428.69 g/mol. Its IUPAC name is N-(4-aminobutyl)-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzamide.
| Compound Name | N-(4-aminobutyl)-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 73056177 |
| Molecular Formula | C26H40N2OS |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | N-(4-aminobutyl)-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSc1ccccc1C(=O)NCCCCN |
| InChI | InChI=1S/C26H40N2OS/c1-21(2)11-9-12-22(3)13-10-14-23(4)17-20-30-25-16-6-5-15-24(25)26(29)28-19-8-7-18-27/h5-6,11,13,15-17H,7-10,12,14,18-20,27H2,1-4H3,(H,28,29)/b22-13+,23-17+ |
| InChIKey | LACNTPHPFVABJE-FQLUOEGPSA-N |
| XLogP | 6.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|