About 2-[2-(3,5-dimethoxyphenyl)ethyl]-6-(1-methylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazine
2-[2-(3,5-dimethoxyphenyl)ethyl]-6-(1-methylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazine (PubChem CID 73056238) has the molecular formula C20H21N5O2
and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-[2-(3,5-dimethoxyphenyl)ethyl]-6-(1-methylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 2-[2-(3,5-dimethoxyphenyl)ethyl]-6-(1-methylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazine |
| PubChem CID | 73056238 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-[2-(3,5-dimethoxyphenyl)ethyl]-6-(1-methylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazine |
| SMILES | COc1cc(CCc2cnc3[nH]c(-c4cnn(C)c4)cc3n2)cc(OC)c1 |
| InChI | InChI=1S/C20H21N5O2/c1-25-12-14(10-22-25)18-9-19-20(24-18)21-11-15(23-19)5-4-13-6-16(26-2)8-17(7-13)27-3/h6-12H,4-5H2,1-3H3,(H,21,24) |
| InChIKey | GQFPDNJSMPAGFB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-(3,5-dimethoxyphenyl)ethyl]-6-(1-methylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,5-dimethoxyphenyl)ethyl]-6-(1-methylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazine?
The IUPAC name of 2-[2-(3,5-dimethoxyphenyl)ethyl]-6-(1-methylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazine (CID 73056238) is 2-[2-(3,5-dimethoxyphenyl)ethyl]-6-(1-methylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazine.
What is the SMILES notation for 2-[2-(3,5-dimethoxyphenyl)ethyl]-6-(1-methylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazine?
The canonical SMILES for 2-[2-(3,5-dimethoxyphenyl)ethyl]-6-(1-methylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazine is COc1cc(CCc2cnc3[nH]c(-c4cnn(C)c4)cc3n2)cc(OC)c1.
What is the InChIKey of 2-[2-(3,5-dimethoxyphenyl)ethyl]-6-(1-methylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazine?
The InChIKey is GQFPDNJSMPAGFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N5O2/c1-25-12-14(10-22-25)18-9-19-20(24-18)21-11-15(23-19)5-4-13-6-16(26-2)8-17(7-13)27-3/h6-12H,4-5H2,1-3H3,(H,21,24).
What are the key properties of 2-[2-(3,5-dimethoxyphenyl)ethyl]-6-(1-methylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazine?
2-[2-(3,5-dimethoxyphenyl)ethyl]-6-(1-methylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazine has a molecular weight of 363.42 g/mol, XLogP of 3.16, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,5-dimethoxyphenyl)ethyl]-6-(1-methylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazine is sourced from PubChem (CID 73056238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).