C27H29Cl2N5O2 — CID 73057153
2-[2-(2,6-dichloro-3,5-dimethoxyphenyl)ethyl]-6-[4-(4-methylpiperazin-1-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazine (PubChem CID 73057153) has the molecular formula C27H29Cl2N5O2 and a molecular weight of 526.47 g/mol. Its IUPAC name is 2-[2-(2,6-dichloro-3,5-dimethoxyphenyl)ethyl]-6-[4-(4-methylpiperazin-1-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazine.
| Compound Name | 2-[2-(2,6-dichloro-3,5-dimethoxyphenyl)ethyl]-6-[4-(4-methylpiperazin-1-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazine |
|---|---|
| PubChem CID | 73057153 |
| Molecular Formula | C27H29Cl2N5O2 |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | 2-[2-(2,6-dichloro-3,5-dimethoxyphenyl)ethyl]-6-[4-(4-methylpiperazin-1-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazine |
| SMILES | COc1cc(OC)c(Cl)c(CCc2cnc3[nH]c(-c4ccc(N5CCN(C)CC5)cc4)cc3n2)c1Cl |
| InChI | InChI=1S/C27H29Cl2N5O2/c1-33-10-12-34(13-11-33)19-7-4-17(5-8-19)21-14-22-27(32-21)30-16-18(31-22)6-9-20-25(28)23(35-2)15-24(36-3)26(20)29/h4-5,7-8,14-16H,6,9-13H2,1-3H3,(H,30,32) |
| InChIKey | BUVHIIBBPCBDBT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 66.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|