C18H32O10S2 — CID 73057191
6,8-bis[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]sulfanyl]octanoic acid (PubChem CID 73057191) has the molecular formula C18H32O10S2 and a molecular weight of 472.58 g/mol. Its IUPAC name is 6,8-bis[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]sulfanyl]octanoic acid.
| Compound Name | 6,8-bis[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]sulfanyl]octanoic acid |
|---|---|
| PubChem CID | 73057191 |
| Molecular Formula | C18H32O10S2 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 6,8-bis[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]sulfanyl]octanoic acid |
| SMILES | O=C(O)CCCCC(CCS[C@@H]1OC[C@@H](O)[C@H](O)C1O)S[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H32O10S2/c19-10-7-27-17(15(25)13(10)23)29-6-5-9(3-1-2-4-12(21)22)30-18-16(26)14(24)11(20)8-28-18/h9-11,13-20,23-26H,1-8H2,(H,21,22)/t9?,10-,11-,13+,14+,15?,16-,17+,18+/m1/s1 |
| InChIKey | OSLAGGQXFFZONY-GJCBXFELSA-N |
| XLogP | -1.27 |
| TPSA | 177.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|