C5HF9O — CID 73057419
2,2,3,3,4,5,5,6,6-nonafluorooxane (PubChem CID 73057419) has the molecular formula C5HF9O and a molecular weight of 248.04 g/mol. Its IUPAC name is 2,2,3,3,4,5,5,6,6-nonafluorooxane.
| Compound Name | 2,2,3,3,4,5,5,6,6-nonafluorooxane |
|---|---|
| PubChem CID | 73057419 |
| Molecular Formula | C5HF9O |
| Molecular Weight | 248.04 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 2,2,3,3,4,5,5,6,6-nonafluorooxane |
| SMILES | FC1C(F)(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C5HF9O/c6-1-2(7,8)4(11,12)15-5(13,14)3(1,9)10/h1H |
| InChIKey | ZBUXMGZYFYSMPA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.04 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|