About [2-amino-4-(2,2-dimethylpropyl)-5-(4-methoxyphenyl)thiophen-3-yl]-(4-chlorophenyl)methanone
[2-amino-4-(2,2-dimethylpropyl)-5-(4-methoxyphenyl)thiophen-3-yl]-(4-chlorophenyl)methanone (PubChem CID 73057678) has the molecular formula C23H24ClNO2S
and a molecular weight of 413.97 g/mol. Its IUPAC name is [2-amino-4-(2,2-dimethylpropyl)-5-(4-methoxyphenyl)thiophen-3-yl]-(4-chlorophenyl)methanone.
Molecular Properties
| Compound Name | [2-amino-4-(2,2-dimethylpropyl)-5-(4-methoxyphenyl)thiophen-3-yl]-(4-chlorophenyl)methanone |
| PubChem CID | 73057678 |
| Molecular Formula | C23H24ClNO2S |
| Molecular Weight | 413.97 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | [2-amino-4-(2,2-dimethylpropyl)-5-(4-methoxyphenyl)thiophen-3-yl]-(4-chlorophenyl)methanone |
| SMILES | COc1ccc(-c2sc(N)c(C(=O)c3ccc(Cl)cc3)c2CC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H24ClNO2S/c1-23(2,3)13-18-19(20(26)14-5-9-16(24)10-6-14)22(25)28-21(18)15-7-11-17(27-4)12-8-15/h5-12H,13,25H2,1-4H3 |
| InChIKey | IAANQOOHGOOIIZ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.97 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|
Analyze [2-amino-4-(2,2-dimethylpropyl)-5-(4-methoxyphenyl)thiophen-3-yl]-(4-chlorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-amino-4-(2,2-dimethylpropyl)-5-(4-methoxyphenyl)thiophen-3-yl]-(4-chlorophenyl)methanone?
The IUPAC name of [2-amino-4-(2,2-dimethylpropyl)-5-(4-methoxyphenyl)thiophen-3-yl]-(4-chlorophenyl)methanone (CID 73057678) is [2-amino-4-(2,2-dimethylpropyl)-5-(4-methoxyphenyl)thiophen-3-yl]-(4-chlorophenyl)methanone.
What is the SMILES notation for [2-amino-4-(2,2-dimethylpropyl)-5-(4-methoxyphenyl)thiophen-3-yl]-(4-chlorophenyl)methanone?
The canonical SMILES for [2-amino-4-(2,2-dimethylpropyl)-5-(4-methoxyphenyl)thiophen-3-yl]-(4-chlorophenyl)methanone is COc1ccc(-c2sc(N)c(C(=O)c3ccc(Cl)cc3)c2CC(C)(C)C)cc1.
What is the InChIKey of [2-amino-4-(2,2-dimethylpropyl)-5-(4-methoxyphenyl)thiophen-3-yl]-(4-chlorophenyl)methanone?
The InChIKey is IAANQOOHGOOIIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24ClNO2S/c1-23(2,3)13-18-19(20(26)14-5-9-16(24)10-6-14)22(25)28-21(18)15-7-11-17(27-4)12-8-15/h5-12H,13,25H2,1-4H3.
What are the key properties of [2-amino-4-(2,2-dimethylpropyl)-5-(4-methoxyphenyl)thiophen-3-yl]-(4-chlorophenyl)methanone?
[2-amino-4-(2,2-dimethylpropyl)-5-(4-methoxyphenyl)thiophen-3-yl]-(4-chlorophenyl)methanone has a molecular weight of 413.97 g/mol, XLogP of 6.48, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-amino-4-(2,2-dimethylpropyl)-5-(4-methoxyphenyl)thiophen-3-yl]-(4-chlorophenyl)methanone is sourced from PubChem (CID 73057678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).