C13H15F3N4O3 — CID 73057902
5-amino-2,3,6-trimethyl-7-methyliminobenzimidazol-4-one;2,2,2-trifluoroacetic acid (PubChem CID 73057902) has the molecular formula C13H15F3N4O3 and a molecular weight of 332.28 g/mol. Its IUPAC name is 5-amino-2,3,6-trimethyl-7-methyliminobenzimidazol-4-one;2,2,2-trifluoroacetic acid.
| Compound Name | 5-amino-2,3,6-trimethyl-7-methyliminobenzimidazol-4-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 73057902 |
| Molecular Formula | C13H15F3N4O3 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 5-amino-2,3,6-trimethyl-7-methyliminobenzimidazol-4-one;2,2,2-trifluoroacetic acid |
| SMILES | C/N=C1\C(C)=C(N)C(=O)c2c1nc(C)n2C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H14N4O.C2HF3O2/c1-5-7(12)11(16)10-9(8(5)13-3)14-6(2)15(10)4;3-2(4,5)1(6)7/h12H2,1-4H3;(H,6,7)/b13-8+; |
| InChIKey | YPTRXLJFOKNVTF-FNXZNAJJSA-N |
| XLogP | 1.21 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|