About O-butan-2-yl [4-(4-fluorophenyl)-4-oxo-1-trimethylsilylbutyl]sulfanylmethanethioate
O-butan-2-yl [4-(4-fluorophenyl)-4-oxo-1-trimethylsilylbutyl]sulfanylmethanethioate (PubChem CID 73058137) has the molecular formula C18H27FO2S2Si
and a molecular weight of 386.63 g/mol. Its IUPAC name is O-butan-2-yl [4-(4-fluorophenyl)-4-oxo-1-trimethylsilylbutyl]sulfanylmethanethioate.
Molecular Properties
| Compound Name | O-butan-2-yl [4-(4-fluorophenyl)-4-oxo-1-trimethylsilylbutyl]sulfanylmethanethioate |
| PubChem CID | 73058137 |
| Molecular Formula | C18H27FO2S2Si |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | O-butan-2-yl [4-(4-fluorophenyl)-4-oxo-1-trimethylsilylbutyl]sulfanylmethanethioate |
| SMILES | CCC(C)OC(=S)SC(CCC(=O)c1ccc(F)cc1)[Si](C)(C)C |
| InChI | InChI=1S/C18H27FO2S2Si/c1-6-13(2)21-18(22)23-17(24(3,4)5)12-11-16(20)14-7-9-15(19)10-8-14/h7-10,13,17H,6,11-12H2,1-5H3 |
| InChIKey | WUFQEMIVHPHOEY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-butan-2-yl [4-(4-fluorophenyl)-4-oxo-1-trimethylsilylbutyl]sulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-butan-2-yl [4-(4-fluorophenyl)-4-oxo-1-trimethylsilylbutyl]sulfanylmethanethioate?
The IUPAC name of O-butan-2-yl [4-(4-fluorophenyl)-4-oxo-1-trimethylsilylbutyl]sulfanylmethanethioate (CID 73058137) is O-butan-2-yl [4-(4-fluorophenyl)-4-oxo-1-trimethylsilylbutyl]sulfanylmethanethioate.
What is the SMILES notation for O-butan-2-yl [4-(4-fluorophenyl)-4-oxo-1-trimethylsilylbutyl]sulfanylmethanethioate?
The canonical SMILES for O-butan-2-yl [4-(4-fluorophenyl)-4-oxo-1-trimethylsilylbutyl]sulfanylmethanethioate is CCC(C)OC(=S)SC(CCC(=O)c1ccc(F)cc1)[Si](C)(C)C.
What is the InChIKey of O-butan-2-yl [4-(4-fluorophenyl)-4-oxo-1-trimethylsilylbutyl]sulfanylmethanethioate?
The InChIKey is WUFQEMIVHPHOEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27FO2S2Si/c1-6-13(2)21-18(22)23-17(24(3,4)5)12-11-16(20)14-7-9-15(19)10-8-14/h7-10,13,17H,6,11-12H2,1-5H3.
What are the key properties of O-butan-2-yl [4-(4-fluorophenyl)-4-oxo-1-trimethylsilylbutyl]sulfanylmethanethioate?
O-butan-2-yl [4-(4-fluorophenyl)-4-oxo-1-trimethylsilylbutyl]sulfanylmethanethioate has a molecular weight of 386.63 g/mol, XLogP of 5.87, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-butan-2-yl [4-(4-fluorophenyl)-4-oxo-1-trimethylsilylbutyl]sulfanylmethanethioate is sourced from PubChem (CID 73058137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).