C19H20O2S — CID 73060224
ethyl 4-(4-methylphenyl)sulfanyltricyclo[4.2.1.02,5]nona-3,7-diene-3-carboxylate (PubChem CID 73060224) has the molecular formula C19H20O2S and a molecular weight of 312.43 g/mol. Its IUPAC name is ethyl 4-(4-methylphenyl)sulfanyltricyclo[4.2.1.02,5]nona-3,7-diene-3-carboxylate.
| Compound Name | ethyl 4-(4-methylphenyl)sulfanyltricyclo[4.2.1.02,5]nona-3,7-diene-3-carboxylate |
|---|---|
| PubChem CID | 73060224 |
| Molecular Formula | C19H20O2S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | ethyl 4-(4-methylphenyl)sulfanyltricyclo[4.2.1.02,5]nona-3,7-diene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(Sc2ccc(C)cc2)C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C19H20O2S/c1-3-21-19(20)17-15-12-6-7-13(10-12)16(15)18(17)22-14-8-4-11(2)5-9-14/h4-9,12-13,15-16H,3,10H2,1-2H3 |
| InChIKey | ILYLWVQDWZQYTN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|