C18H19N5S — CID 7306199
4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-(3-phenyl-1H-pyrazol-5-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 7306199) has the molecular formula C18H19N5S and a molecular weight of 337.45 g/mol. Its IUPAC name is 4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-(3-phenyl-1H-pyrazol-5-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-(3-phenyl-1H-pyrazol-5-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 7306199 |
| Molecular Formula | C18H19N5S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-(3-phenyl-1H-pyrazol-5-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2cc(-c3ccccc3)n[nH]2)n1[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C18H19N5S/c24-18-22-21-17(23(18)16-9-11-6-7-13(16)8-11)15-10-14(19-20-15)12-4-2-1-3-5-12/h1-5,10-11,13,16H,6-9H2,(H,19,20)(H,22,24)/t11-,13-,16-/m0/s1 |
| InChIKey | OSFZORVBUDRRDS-RBOXIYTFSA-N |
| XLogP | 4.36 |
| TPSA | 62.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|