C15H19NO2 — CID 73062331
3-benzyl-5-ethenyl-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 73062331) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 3-benzyl-5-ethenyl-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | 3-benzyl-5-ethenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 73062331 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 3-benzyl-5-ethenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | C=CC1OC(=O)N(Cc2ccccc2)C1C(C)C |
| InChI | InChI=1S/C15H19NO2/c1-4-13-14(11(2)3)16(15(17)18-13)10-12-8-6-5-7-9-12/h4-9,11,13-14H,1,10H2,2-3H3 |
| InChIKey | RQGDIBMOHYENHP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|