C20H18N2O3S — CID 7306493
methyl (2S)-2-phenyl-2-[(2-quinolin-2-ylsulfanylacetyl)amino]acetate (PubChem CID 7306493) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is methyl (2S)-2-phenyl-2-[(2-quinolin-2-ylsulfanylacetyl)amino]acetate.
| Compound Name | methyl (2S)-2-phenyl-2-[(2-quinolin-2-ylsulfanylacetyl)amino]acetate |
|---|---|
| PubChem CID | 7306493 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | methyl (2S)-2-phenyl-2-[(2-quinolin-2-ylsulfanylacetyl)amino]acetate |
| SMILES | COC(=O)[C@@H](NC(=O)CSc1ccc2ccccc2n1)c1ccccc1 |
| InChI | InChI=1S/C20H18N2O3S/c1-25-20(24)19(15-8-3-2-4-9-15)22-17(23)13-26-18-12-11-14-7-5-6-10-16(14)21-18/h2-12,19H,13H2,1H3,(H,22,23)/t19-/m0/s1 |
| InChIKey | KKYWDYPXBVHDOW-IBGZPJMESA-N |
| XLogP | 3.36 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |