About 1-amino-3-phenylthiourea
1-amino-3-phenylthiourea (PubChem CID 730679) has the molecular formula C7H9N3S
and a molecular weight of 167.24 g/mol. Its IUPAC name is 1-amino-3-phenylthiourea.
Molecular Properties
| Compound Name | 1-amino-3-phenylthiourea |
| PubChem CID | 730679 |
| Molecular Formula | C7H9N3S |
| Molecular Weight | 167.24 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 1-amino-3-phenylthiourea |
| SMILES | NNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C7H9N3S/c8-10-7(11)9-6-4-2-1-3-5-6/h1-5H,8H2,(H2,9,10,11) |
| InChIKey | KKIGUVBJOHCXSP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-phenylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-phenylthiourea?
The IUPAC name of 1-amino-3-phenylthiourea (CID 730679) is 1-amino-3-phenylthiourea.
What is the SMILES notation for 1-amino-3-phenylthiourea?
The canonical SMILES for 1-amino-3-phenylthiourea is NNC(=S)Nc1ccccc1.
What is the InChIKey of 1-amino-3-phenylthiourea?
The InChIKey is KKIGUVBJOHCXSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3S/c8-10-7(11)9-6-4-2-1-3-5-6/h1-5H,8H2,(H2,9,10,11).
What are the key properties of 1-amino-3-phenylthiourea?
1-amino-3-phenylthiourea has a molecular weight of 167.24 g/mol, XLogP of 0.85, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-phenylthiourea is sourced from PubChem (CID 730679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).