C24H24N3O2+ — CID 7307119
7-[(R)-(2-methoxyphenyl)-[(6-methylpyridin-1-ium-2-yl)amino]methyl]-2-methylquinolin-8-ol (PubChem CID 7307119) has the molecular formula C24H24N3O2+ and a molecular weight of 386.48 g/mol. Its IUPAC name is 7-[(R)-(2-methoxyphenyl)-[(6-methylpyridin-1-ium-2-yl)amino]methyl]-2-methylquinolin-8-ol.
| Compound Name | 7-[(R)-(2-methoxyphenyl)-[(6-methylpyridin-1-ium-2-yl)amino]methyl]-2-methylquinolin-8-ol |
|---|---|
| PubChem CID | 7307119 |
| Molecular Formula | C24H24N3O2+ |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 7-[(R)-(2-methoxyphenyl)-[(6-methylpyridin-1-ium-2-yl)amino]methyl]-2-methylquinolin-8-ol |
| SMILES | COc1ccccc1[C@H](Nc1cccc(C)[nH+]1)c1ccc2ccc(C)nc2c1O |
| InChI | InChI=1S/C24H23N3O2/c1-15-7-6-10-21(25-15)27-23(18-8-4-5-9-20(18)29-3)19-14-13-17-12-11-16(2)26-22(17)24(19)28/h4-14,23,28H,1-3H3,(H,25,27)/p+1/t23-/m0/s1 |
| InChIKey | JBJMZAKMNZUUJB-QHCPKHFHSA-O |
| XLogP | 4.58 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|