C22H36O4 — CID 73071973
1,3-dioxan-5-yl octadeca-6,9,12-trienoate (PubChem CID 73071973) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is 1,3-dioxan-5-yl octadeca-6,9,12-trienoate.
| Compound Name | 1,3-dioxan-5-yl octadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 73071973 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 1,3-dioxan-5-yl octadeca-6,9,12-trienoate |
| SMILES | CCCCCC=CCC=CCC=CCCCCC(=O)OC1COCOC1 |
| InChI | InChI=1S/C22H36O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(23)26-21-18-24-20-25-19-21/h6-7,9-10,12-13,21H,2-5,8,11,14-20H2,1H3 |
| InChIKey | CDMIHGQHXYTDIH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|