2,5-bis(bromomethyl)thiolane 1,1-dioxide

C6H10Br2O2S — CID 73073732

IUPAC2,5-bis(bromomethyl)thiolane 1,1-dioxide
SMILESO=S1(=O)C(CBr)CCC1CBr
InChIInChI=1S/C6H10Br2O2S/c7-3-5-1-2-6(4-8)11(5,9)10/h5-6H,1-4H2
InChIKeyMMFLTMWJTGLDBE-UHFFFAOYSA-N
MW306.02 g/mol
LogP1.72
Rot. Bonds2

About 2,5-bis(bromomethyl)thiolane 1,1-dioxide

2,5-bis(bromomethyl)thiolane 1,1-dioxide (PubChem CID 73073732) has the molecular formula C6H10Br2O2S and a molecular weight of 306.02 g/mol. Its IUPAC name is 2,5-bis(bromomethyl)thiolane 1,1-dioxide.

Molecular Properties

Compound Name2,5-bis(bromomethyl)thiolane 1,1-dioxide
PubChem CID73073732
Molecular FormulaC6H10Br2O2S
Molecular Weight306.02 g/mol
Exact Mass303.88
IUPAC Name2,5-bis(bromomethyl)thiolane 1,1-dioxide
SMILESO=S1(=O)C(CBr)CCC1CBr
InChIInChI=1S/C6H10Br2O2S/c7-3-5-1-2-6(4-8)11(5,9)10/h5-6H,1-4H2
InChIKeyMMFLTMWJTGLDBE-UHFFFAOYSA-N
XLogP1.72
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.02
LogP ≤ 51.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 2,5-bis(bromomethyl)thiolane 1,1-dioxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-bis(bromomethyl)thiolane 1,1-dioxide?
The IUPAC name of 2,5-bis(bromomethyl)thiolane 1,1-dioxide (CID 73073732) is 2,5-bis(bromomethyl)thiolane 1,1-dioxide.
What is the SMILES notation for 2,5-bis(bromomethyl)thiolane 1,1-dioxide?
The canonical SMILES for 2,5-bis(bromomethyl)thiolane 1,1-dioxide is O=S1(=O)C(CBr)CCC1CBr.
What is the InChIKey of 2,5-bis(bromomethyl)thiolane 1,1-dioxide?
The InChIKey is MMFLTMWJTGLDBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10Br2O2S/c7-3-5-1-2-6(4-8)11(5,9)10/h5-6H,1-4H2.
What are the key properties of 2,5-bis(bromomethyl)thiolane 1,1-dioxide?
2,5-bis(bromomethyl)thiolane 1,1-dioxide has a molecular weight of 306.02 g/mol, XLogP of 1.72, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(bromomethyl)thiolane 1,1-dioxide is sourced from PubChem (CID 73073732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).