C16H20FNO4 — CID 73073795
benzyl 7-fluoro-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate (PubChem CID 73073795) has the molecular formula C16H20FNO4 and a molecular weight of 309.34 g/mol. Its IUPAC name is benzyl 7-fluoro-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate.
| Compound Name | benzyl 7-fluoro-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 73073795 |
| Molecular Formula | C16H20FNO4 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | benzyl 7-fluoro-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
| SMILES | CC1(C)OC2CN(C(=O)OCc3ccccc3)CC(F)C2O1 |
| InChI | InChI=1S/C16H20FNO4/c1-16(2)21-13-9-18(8-12(17)14(13)22-16)15(19)20-10-11-6-4-3-5-7-11/h3-7,12-14H,8-10H2,1-2H3 |
| InChIKey | JAZAKVZFAYMXCO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |