C23H29NO — CID 73074312
4-ethyl-N-(2-methyl-3-phenylprop-2-enyl)-N-(2-methylpropyl)benzamide (PubChem CID 73074312) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is 4-ethyl-N-(2-methyl-3-phenylprop-2-enyl)-N-(2-methylpropyl)benzamide.
| Compound Name | 4-ethyl-N-(2-methyl-3-phenylprop-2-enyl)-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 73074312 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 4-ethyl-N-(2-methyl-3-phenylprop-2-enyl)-N-(2-methylpropyl)benzamide |
| SMILES | CCc1ccc(C(=O)N(CC(C)=Cc2ccccc2)CC(C)C)cc1 |
| InChI | InChI=1S/C23H29NO/c1-5-20-11-13-22(14-12-20)23(25)24(16-18(2)3)17-19(4)15-21-9-7-6-8-10-21/h6-15,18H,5,16-17H2,1-4H3 |
| InChIKey | FTLPXORBCCKUOD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |