C24H32O2 — CID 73074655
3-(4-ethyl-1,3,7-trimethyl-5-phenyl-1,2,3,3a,5,7a-hexahydroinden-4-yl)-2-methylprop-2-enoic acid (PubChem CID 73074655) has the molecular formula C24H32O2 and a molecular weight of 352.52 g/mol. Its IUPAC name is 3-(4-ethyl-1,3,7-trimethyl-5-phenyl-1,2,3,3a,5,7a-hexahydroinden-4-yl)-2-methylprop-2-enoic acid.
| Compound Name | 3-(4-ethyl-1,3,7-trimethyl-5-phenyl-1,2,3,3a,5,7a-hexahydroinden-4-yl)-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 73074655 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 3-(4-ethyl-1,3,7-trimethyl-5-phenyl-1,2,3,3a,5,7a-hexahydroinden-4-yl)-2-methylprop-2-enoic acid |
| SMILES | CCC1(C=C(C)C(=O)O)C(c2ccccc2)C=C(C)C2C(C)CC(C)C21 |
| InChI | InChI=1S/C24H32O2/c1-6-24(14-18(5)23(25)26)20(19-10-8-7-9-11-19)13-16(3)21-15(2)12-17(4)22(21)24/h7-11,13-15,17,20-22H,6,12H2,1-5H3,(H,25,26) |
| InChIKey | NZZHSJZMHIQBPW-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|