C19H21N2O3- — CID 7307672
(2S)-4-(4-cyclohexylphenyl)-2-imidazol-1-yl-4-oxobutanoate (PubChem CID 7307672) has the molecular formula C19H21N2O3- and a molecular weight of 325.39 g/mol. Its IUPAC name is (2S)-4-(4-cyclohexylphenyl)-2-imidazol-1-yl-4-oxobutanoate.
| Compound Name | (2S)-4-(4-cyclohexylphenyl)-2-imidazol-1-yl-4-oxobutanoate |
|---|---|
| PubChem CID | 7307672 |
| Molecular Formula | C19H21N2O3- |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (2S)-4-(4-cyclohexylphenyl)-2-imidazol-1-yl-4-oxobutanoate |
| SMILES | O=C(C[C@@H](C(=O)[O-])n1ccnc1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C19H22N2O3/c22-18(12-17(19(23)24)21-11-10-20-13-21)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h6-11,13-14,17H,1-5,12H2,(H,23,24)/p-1/t17-/m0/s1 |
| InChIKey | JAEVIBGVMKCWNM-KRWDZBQOSA-M |
| XLogP | 2.49 |
| TPSA | 75.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |