About 2-butanimidoyl-5,5-dimethylcyclohexane-1,3-dione
2-butanimidoyl-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 7307931) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-butanimidoyl-5,5-dimethylcyclohexane-1,3-dione.
Molecular Properties
| Compound Name | 2-butanimidoyl-5,5-dimethylcyclohexane-1,3-dione |
| PubChem CID | 7307931 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 2-butanimidoyl-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | [H]/N=C(\CCC)C1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C12H19NO2/c1-4-5-8(13)11-9(14)6-12(2,3)7-10(11)15/h11,13H,4-7H2,1-3H3/b13-8+ |
| InChIKey | NCBHUCBMEMQYMG-MDWZMJQESA-N |
| XLogP | 2.38 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-butanimidoyl-5,5-dimethylcyclohexane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butanimidoyl-5,5-dimethylcyclohexane-1,3-dione?
The IUPAC name of 2-butanimidoyl-5,5-dimethylcyclohexane-1,3-dione (CID 7307931) is 2-butanimidoyl-5,5-dimethylcyclohexane-1,3-dione.
What is the SMILES notation for 2-butanimidoyl-5,5-dimethylcyclohexane-1,3-dione?
The canonical SMILES for 2-butanimidoyl-5,5-dimethylcyclohexane-1,3-dione is [H]/N=C(\CCC)C1C(=O)CC(C)(C)CC1=O.
What is the InChIKey of 2-butanimidoyl-5,5-dimethylcyclohexane-1,3-dione?
The InChIKey is NCBHUCBMEMQYMG-MDWZMJQESA-N. The full InChI is InChI=1S/C12H19NO2/c1-4-5-8(13)11-9(14)6-12(2,3)7-10(11)15/h11,13H,4-7H2,1-3H3/b13-8+.
What are the key properties of 2-butanimidoyl-5,5-dimethylcyclohexane-1,3-dione?
2-butanimidoyl-5,5-dimethylcyclohexane-1,3-dione has a molecular weight of 209.29 g/mol, XLogP of 2.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butanimidoyl-5,5-dimethylcyclohexane-1,3-dione is sourced from PubChem (CID 7307931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).