C18H29NO4 — CID 7307937
cis-methyl (1S,5S)-5-butanoyl-4-tert-butylimino-2,2-dimethyl-6-oxocyclohexane-1-carboxylate (PubChem CID 7307937) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is cis-methyl (1S,5S)-5-butanoyl-4-tert-butylimino-2,2-dimethyl-6-oxocyclohexane-1-carboxylate.
| Compound Name | cis-methyl (1S,5S)-5-butanoyl-4-tert-butylimino-2,2-dimethyl-6-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 7307937 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | cis-methyl (1S,5S)-5-butanoyl-4-tert-butylimino-2,2-dimethyl-6-oxocyclohexane-1-carboxylate |
| SMILES | CCCC(=O)[C@H]1C(=O)[C@@H](C(=O)OC)C(C)(C)C/C1=N\C(C)(C)C |
| InChI | InChI=1S/C18H29NO4/c1-8-9-12(20)13-11(19-17(2,3)4)10-18(5,6)14(15(13)21)16(22)23-7/h13-14H,8-10H2,1-7H3/b19-11+/t13-,14-/m0/s1 |
| InChIKey | NNJZLIKONRFAPG-FKWQJMJJSA-N |
| XLogP | 3.00 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|