About 2-(4-methoxyphenyl)spiro[1H-isoquinolin-2-ium-4,4'-oxane]-3-amine
2-(4-methoxyphenyl)spiro[1H-isoquinolin-2-ium-4,4'-oxane]-3-amine (PubChem CID 7308106) has the molecular formula C20H23N2O2+
and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)spiro[1H-isoquinolin-2-ium-4,4'-oxane]-3-amine.
Molecular Properties
| Compound Name | 2-(4-methoxyphenyl)spiro[1H-isoquinolin-2-ium-4,4'-oxane]-3-amine |
| PubChem CID | 7308106 |
| Molecular Formula | C20H23N2O2+ |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 2-(4-methoxyphenyl)spiro[1H-isoquinolin-2-ium-4,4'-oxane]-3-amine |
| SMILES | COc1ccc([N+]2=C(N)C3(CCOCC3)c3ccccc3C2)cc1 |
| InChI | InChI=1S/C20H22N2O2/c1-23-17-8-6-16(7-9-17)22-14-15-4-2-3-5-18(15)20(19(22)21)10-12-24-13-11-20/h2-9,21H,10-14H2,1H3/p+1 |
| InChIKey | PIDULFZWFREYQB-UHFFFAOYSA-O |
| XLogP | 2.96 |
| TPSA | 47.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methoxyphenyl)spiro[1H-isoquinolin-2-ium-4,4'-oxane]-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyphenyl)spiro[1H-isoquinolin-2-ium-4,4'-oxane]-3-amine?
The IUPAC name of 2-(4-methoxyphenyl)spiro[1H-isoquinolin-2-ium-4,4'-oxane]-3-amine (CID 7308106) is 2-(4-methoxyphenyl)spiro[1H-isoquinolin-2-ium-4,4'-oxane]-3-amine.
What is the SMILES notation for 2-(4-methoxyphenyl)spiro[1H-isoquinolin-2-ium-4,4'-oxane]-3-amine?
The canonical SMILES for 2-(4-methoxyphenyl)spiro[1H-isoquinolin-2-ium-4,4'-oxane]-3-amine is COc1ccc([N+]2=C(N)C3(CCOCC3)c3ccccc3C2)cc1.
What is the InChIKey of 2-(4-methoxyphenyl)spiro[1H-isoquinolin-2-ium-4,4'-oxane]-3-amine?
The InChIKey is PIDULFZWFREYQB-UHFFFAOYSA-O. The full InChI is InChI=1S/C20H22N2O2/c1-23-17-8-6-16(7-9-17)22-14-15-4-2-3-5-18(15)20(19(22)21)10-12-24-13-11-20/h2-9,21H,10-14H2,1H3/p+1.
What are the key properties of 2-(4-methoxyphenyl)spiro[1H-isoquinolin-2-ium-4,4'-oxane]-3-amine?
2-(4-methoxyphenyl)spiro[1H-isoquinolin-2-ium-4,4'-oxane]-3-amine has a molecular weight of 323.42 g/mol, XLogP of 2.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyphenyl)spiro[1H-isoquinolin-2-ium-4,4'-oxane]-3-amine is sourced from PubChem (CID 7308106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).