C16H21F4N5O4 — CID 73082321
1-[amino-[3-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)oxy]propoxyamino]methylidene]-2-propan-2-ylguanidine (PubChem CID 73082321) has the molecular formula C16H21F4N5O4 and a molecular weight of 423.37 g/mol. Its IUPAC name is 1-[amino-[3-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)oxy]propoxyamino]methylidene]-2-propan-2-ylguanidine.
| Compound Name | 1-[amino-[3-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)oxy]propoxyamino]methylidene]-2-propan-2-ylguanidine |
|---|---|
| PubChem CID | 73082321 |
| Molecular Formula | C16H21F4N5O4 |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 1-[amino-[3-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)oxy]propoxyamino]methylidene]-2-propan-2-ylguanidine |
| SMILES | CC(C)/N=C(\N)N=C(N)NOCCCOc1ccc2c(c1)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C16H21F4N5O4/c1-9(2)23-13(21)24-14(22)25-27-7-3-6-26-10-4-5-11-12(8-10)29-16(19,20)15(17,18)28-11/h4-5,8-9H,3,6-7H2,1-2H3,(H5,21,22,23,24,25) |
| InChIKey | PJLCHIKXZQTOKG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|